C16H20N2O4S — CID 175688859
butyl N-[5-[hydroxy-(3-methoxyphenyl)methyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 175688859) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is butyl N-[5-[hydroxy-(3-methoxyphenyl)methyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | butyl N-[5-[hydroxy-(3-methoxyphenyl)methyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 175688859 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | butyl N-[5-[hydroxy-(3-methoxyphenyl)methyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1ncc(C(O)c2cccc(OC)c2)s1 |
| InChI | InChI=1S/C16H20N2O4S/c1-3-4-8-22-16(20)18-15-17-10-13(23-15)14(19)11-6-5-7-12(9-11)21-2/h5-7,9-10,14,19H,3-4,8H2,1-2H3,(H,17,18,20) |
| InChIKey | CEOGVCFFEBUOHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|