C23H28FNO2 — CID 138473789
[3-fluoro-4-(2-hydroxy-2-methylpropyl)phenyl]-(4-methyl-4-phenylpiperidin-1-yl)methanone (PubChem CID 138473789) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is [3-fluoro-4-(2-hydroxy-2-methylpropyl)phenyl]-(4-methyl-4-phenylpiperidin-1-yl)methanone.
| Compound Name | [3-fluoro-4-(2-hydroxy-2-methylpropyl)phenyl]-(4-methyl-4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 138473789 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [3-fluoro-4-(2-hydroxy-2-methylpropyl)phenyl]-(4-methyl-4-phenylpiperidin-1-yl)methanone |
| SMILES | CC(C)(O)Cc1ccc(C(=O)N2CCC(C)(c3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C23H28FNO2/c1-22(2,27)16-18-10-9-17(15-20(18)24)21(26)25-13-11-23(3,12-14-25)19-7-5-4-6-8-19/h4-10,15,27H,11-14,16H2,1-3H3 |
| InChIKey | MNYCHOFHRAJNEV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |