C7H14N2O — CID 138479529
3-(2-methyl-1,5-dihydropyrazol-4-yl)propan-1-ol (PubChem CID 138479529) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-(2-methyl-1,5-dihydropyrazol-4-yl)propan-1-ol.
| Compound Name | 3-(2-methyl-1,5-dihydropyrazol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 138479529 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-(2-methyl-1,5-dihydropyrazol-4-yl)propan-1-ol |
| SMILES | CN1C=C(CCCO)CN1 |
| InChI | InChI=1S/C7H14N2O/c1-9-6-7(5-8-9)3-2-4-10/h6,8,10H,2-5H2,1H3 |
| InChIKey | IPJJOWXBXSNBEN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |