C21H24N2 — CID 138480551
N,N-dimethyl-1-[2-[(3E)-5-(3-methyl-2-pyridinyl)hexa-1,3,5-trien-2-yl]phenyl]methanamine (PubChem CID 138480551) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is N,N-dimethyl-1-[2-[(3E)-5-(3-methyl-2-pyridinyl)hexa-1,3,5-trien-2-yl]phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[2-[(3E)-5-(3-methyl-2-pyridinyl)hexa-1,3,5-trien-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 138480551 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N,N-dimethyl-1-[2-[(3E)-5-(3-methyl-2-pyridinyl)hexa-1,3,5-trien-2-yl]phenyl]methanamine |
| SMILES | C=C(/C=C/C(=C)c1ncccc1C)c1ccccc1CN(C)C |
| InChI | InChI=1S/C21H24N2/c1-16(20-11-7-6-10-19(20)15-23(4)5)12-13-18(3)21-17(2)9-8-14-22-21/h6-14H,1,3,15H2,2,4-5H3/b13-12+ |
| InChIKey | LLVMFWBUBDNMHW-OUKQBFOZSA-N |
| XLogP | 4.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|