About N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane
N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane (PubChem CID 142073226) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane |
| PubChem CID | 142073226 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane |
| SMILES | C=C(C)c1ccccc1CN(C)C.CC |
| InChI | InChI=1S/C12H17N.C2H6/c1-10(2)12-8-6-5-7-11(12)9-13(3)4;1-2/h5-8H,1,9H2,2-4H3;1-2H3 |
| InChIKey | VFYQTMAMDYYWKK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane?
The IUPAC name of N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane (CID 142073226) is N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane.
What is the SMILES notation for N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane?
The canonical SMILES for N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane is C=C(C)c1ccccc1CN(C)C.CC.
What is the InChIKey of N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane?
The InChIKey is VFYQTMAMDYYWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.C2H6/c1-10(2)12-8-6-5-7-11(12)9-13(3)4;1-2/h5-8H,1,9H2,2-4H3;1-2H3.
What are the key properties of N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane?
N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane has a molecular weight of 205.34 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(2-prop-1-en-2-ylphenyl)methanamine;ethane is sourced from PubChem (CID 142073226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).