C17H34N2O2 — CID 138482808
4,9-diamino-2,2,5,7,7,10-hexamethylundecane-3,8-dione (PubChem CID 138482808) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 4,9-diamino-2,2,5,7,7,10-hexamethylundecane-3,8-dione.
| Compound Name | 4,9-diamino-2,2,5,7,7,10-hexamethylundecane-3,8-dione |
|---|---|
| PubChem CID | 138482808 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 4,9-diamino-2,2,5,7,7,10-hexamethylundecane-3,8-dione |
| SMILES | CC(C)C(N)C(=O)C(C)(C)CC(C)C(N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H34N2O2/c1-10(2)12(18)15(21)17(7,8)9-11(3)13(19)14(20)16(4,5)6/h10-13H,9,18-19H2,1-8H3 |
| InChIKey | NFWWRVKEJKGJDL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |