C22H30N3O3P2S+ — CID 138483704
[[(E)-(4-ethoxyphenyl)methylideneamino]-methylamino]-[2-[4-[methylamino(phosphoroso)methyl]phenoxy]butan-2-yl]-sulfanylidenephosphanium (PubChem CID 138483704) has the molecular formula C22H30N3O3P2S+ and a molecular weight of 478.52 g/mol. Its IUPAC name is [[(E)-(4-ethoxyphenyl)methylideneamino]-methylamino]-[2-[4-[methylamino(phosphoroso)methyl]phenoxy]butan-2-yl]-sulfanylidenephosphanium.
| Compound Name | [[(E)-(4-ethoxyphenyl)methylideneamino]-methylamino]-[2-[4-[methylamino(phosphoroso)methyl]phenoxy]butan-2-yl]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 138483704 |
| Molecular Formula | C22H30N3O3P2S+ |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [[(E)-(4-ethoxyphenyl)methylideneamino]-methylamino]-[2-[4-[methylamino(phosphoroso)methyl]phenoxy]butan-2-yl]-sulfanylidenephosphanium |
| SMILES | CCOc1ccc(/C=N/N(C)[P+](=S)C(C)(CC)Oc2ccc(C(NC)P=O)cc2)cc1 |
| InChI | InChI=1S/C22H30N3O3P2S/c1-6-22(3,28-20-14-10-18(11-15-20)21(23-4)29-26)30(31)25(5)24-16-17-8-12-19(13-9-17)27-7-2/h8-16,21,23H,6-7H2,1-5H3/q+1/b24-16+ |
| InChIKey | OHWXLERXTDYZHL-LFVJCYFKSA-N |
| XLogP | 5.92 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|