C36H49N3O3PS+ — CID 91416952
2-[4-[1-[benzyl(methyl)amino]-2-oxoethyl]phenoxy]pentan-2-yl-[methyl-[[4-(3-methylhexan-3-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium (PubChem CID 91416952) has the molecular formula C36H49N3O3PS+ and a molecular weight of 634.85 g/mol. Its IUPAC name is 2-[4-[1-[benzyl(methyl)amino]-2-oxoethyl]phenoxy]pentan-2-yl-[methyl-[[4-(3-methylhexan-3-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium.
| Compound Name | 2-[4-[1-[benzyl(methyl)amino]-2-oxoethyl]phenoxy]pentan-2-yl-[methyl-[[4-(3-methylhexan-3-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 91416952 |
| Molecular Formula | C36H49N3O3PS+ |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | 2-[4-[1-[benzyl(methyl)amino]-2-oxoethyl]phenoxy]pentan-2-yl-[methyl-[[4-(3-methylhexan-3-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium |
| SMILES | CCCC(C)(CC)Oc1ccc(C=NN(C)[P+](=S)C(C)(CCC)Oc2ccc(C(C=O)N(C)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H49N3O3PS/c1-8-24-35(4,10-3)41-32-20-16-29(17-21-32)26-37-39(7)43(44)36(5,25-9-2)42-33-22-18-31(19-23-33)34(28-40)38(6)27-30-14-12-11-13-15-30/h11-23,26,28,34H,8-10,24-25,27H2,1-7H3/q+1 |
| InChIKey | VHIUIFMBKYSEDL-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|