C27H40N2O3PS+ — CID 91587240
3-[4-(1-hydroxyethyl)phenoxy]hexan-3-yl-[methyl-[[4-(2-methylbutan-2-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium (PubChem CID 91587240) has the molecular formula C27H40N2O3PS+ and a molecular weight of 503.67 g/mol. Its IUPAC name is 3-[4-(1-hydroxyethyl)phenoxy]hexan-3-yl-[methyl-[[4-(2-methylbutan-2-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium.
| Compound Name | 3-[4-(1-hydroxyethyl)phenoxy]hexan-3-yl-[methyl-[[4-(2-methylbutan-2-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 91587240 |
| Molecular Formula | C27H40N2O3PS+ |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-[4-(1-hydroxyethyl)phenoxy]hexan-3-yl-[methyl-[[4-(2-methylbutan-2-yloxy)phenyl]methylideneamino]amino]-sulfanylidenephosphanium |
| SMILES | CCCC(CC)(Oc1ccc(C(C)O)cc1)[P+](=S)N(C)N=Cc1ccc(OC(C)(C)CC)cc1 |
| InChI | InChI=1S/C27H40N2O3PS/c1-8-19-27(10-3,32-25-17-13-23(14-18-25)21(4)30)33(34)29(7)28-20-22-11-15-24(16-12-22)31-26(5,6)9-2/h11-18,20-21,30H,8-10,19H2,1-7H3/q+1 |
| InChIKey | KCAXRMCIJPOAMR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|