C16H23N2OPS — CID 90853113
N-[[4-(2,4-dimethylhex-4-en-2-yloxy)phenyl]methylideneamino]-N-thiophosphorosomethanamine (PubChem CID 90853113) has the molecular formula C16H23N2OPS and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[[4-(2,4-dimethylhex-4-en-2-yloxy)phenyl]methylideneamino]-N-thiophosphorosomethanamine.
| Compound Name | N-[[4-(2,4-dimethylhex-4-en-2-yloxy)phenyl]methylideneamino]-N-thiophosphorosomethanamine |
|---|---|
| PubChem CID | 90853113 |
| Molecular Formula | C16H23N2OPS |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[[4-(2,4-dimethylhex-4-en-2-yloxy)phenyl]methylideneamino]-N-thiophosphorosomethanamine |
| SMILES | CC=C(C)CC(C)(C)Oc1ccc(C=NN(C)P=S)cc1 |
| InChI | InChI=1S/C16H23N2OPS/c1-6-13(2)11-16(3,4)19-15-9-7-14(8-10-15)12-17-18(5)20-21/h6-10,12H,11H2,1-5H3 |
| InChIKey | HUOFBBZJYMDTKR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|