C23H23BrN2O — CID 138492571
N,N-dimethyl-1-(10-methyl-9-phenylacridin-10-ium-3-yl)oxymethanamine bromide (PubChem CID 138492571) has the molecular formula C23H23BrN2O and a molecular weight of 423.35 g/mol. Its IUPAC name is N,N-dimethyl-1-(10-methyl-9-phenylacridin-10-ium-3-yl)oxymethanamine bromide.
| Compound Name | N,N-dimethyl-1-(10-methyl-9-phenylacridin-10-ium-3-yl)oxymethanamine bromide |
|---|---|
| PubChem CID | 138492571 |
| Molecular Formula | C23H23BrN2O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N,N-dimethyl-1-(10-methyl-9-phenylacridin-10-ium-3-yl)oxymethanamine bromide |
| SMILES | CN(C)COc1ccc2c(-c3ccccc3)c3ccccc3[n+](C)c2c1.[Br-] |
| InChI | InChI=1S/C23H23N2O.BrH/c1-24(2)16-26-18-13-14-20-22(15-18)25(3)21-12-8-7-11-19(21)23(20)17-9-5-4-6-10-17;/h4-15H,16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NWZNAPMEJUYUED-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|