C22H18NO3+ — CID 71476808
17-(methoxymethoxy)-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene (PubChem CID 71476808) has the molecular formula C22H18NO3+ and a molecular weight of 344.39 g/mol. Its IUPAC name is 17-(methoxymethoxy)-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene.
| Compound Name | 17-(methoxymethoxy)-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 71476808 |
| Molecular Formula | C22H18NO3+ |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 17-(methoxymethoxy)-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene |
| SMILES | COCOc1ccc2c3cccc4c3c([n+](C)c2c1)-c1ccccc1O4 |
| InChI | InChI=1S/C22H18NO3/c1-23-18-12-14(25-13-24-2)10-11-15(18)16-7-5-9-20-21(16)22(23)17-6-3-4-8-19(17)26-20/h3-12H,13H2,1-2H3/q+1 |
| InChIKey | OSRDFDHVJFEFQA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|