C22H16FNO3 — CID 71477435
2-[(4-fluoro-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl)oxy]ethanolate (PubChem CID 71477435) has the molecular formula C22H16FNO3 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[(4-fluoro-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl)oxy]ethanolate.
| Compound Name | 2-[(4-fluoro-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl)oxy]ethanolate |
|---|---|
| PubChem CID | 71477435 |
| Molecular Formula | C22H16FNO3 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[(4-fluoro-20-methyl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl)oxy]ethanolate |
| SMILES | C[n+]1c2c3c(cccc3c3cc(OCC[O-])ccc31)Oc1ccc(F)cc1-2 |
| InChI | InChI=1S/C22H16FNO3/c1-24-18-7-6-14(26-10-9-25)12-16(18)15-3-2-4-20-21(15)22(24)17-11-13(23)5-8-19(17)27-20/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | YBJMGJWXXJTJFF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|