C23H14F2N3O+ — CID 71144937
4,18-difluoro-20-methyl-17-(1H-pyrazol-4-yl)-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene (PubChem CID 71144937) has the molecular formula C23H14F2N3O+ and a molecular weight of 386.38 g/mol. Its IUPAC name is 4,18-difluoro-20-methyl-17-(1H-pyrazol-4-yl)-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene.
| Compound Name | 4,18-difluoro-20-methyl-17-(1H-pyrazol-4-yl)-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 71144937 |
| Molecular Formula | C23H14F2N3O+ |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 4,18-difluoro-20-methyl-17-(1H-pyrazol-4-yl)-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
| SMILES | C[n+]1c2c3c(cccc3c3ccc(-c4cn[nH]c4)c(F)c31)Oc1ccc(F)cc1-2 |
| InChI | InChI=1S/C23H13F2N3O/c1-28-22-17-9-13(24)5-8-18(17)29-19-4-2-3-15(20(19)22)16-7-6-14(21(25)23(16)28)12-10-26-27-11-12/h2-11H,1H3/p+1 |
| InChIKey | PSKMFAPAAWBZQJ-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|