C20H9F4NO4S — CID 89330693
(4-fluoro-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-17-yl) trifluoromethanesulfonate (PubChem CID 89330693) has the molecular formula C20H9F4NO4S and a molecular weight of 435.35 g/mol. Its IUPAC name is (4-fluoro-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-17-yl) trifluoromethanesulfonate.
| Compound Name | (4-fluoro-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-17-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89330693 |
| Molecular Formula | C20H9F4NO4S |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | (4-fluoro-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-17-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)nc1c3c(cccc32)Oc2ccc(F)cc2-1)C(F)(F)F |
| InChI | InChI=1S/C20H9F4NO4S/c21-10-4-7-16-14(8-10)19-18-13(2-1-3-17(18)28-16)12-6-5-11(9-15(12)25-19)29-30(26,27)20(22,23)24/h1-9H |
| InChIKey | RZBIQMKZIIJYGR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|