C26H22F4N3+ — CID 167484573
3,6-bis(3,3-difluoroazetidin-1-yl)-10-methyl-9-phenylacridin-10-ium (PubChem CID 167484573) has the molecular formula C26H22F4N3+ and a molecular weight of 452.48 g/mol. Its IUPAC name is 3,6-bis(3,3-difluoroazetidin-1-yl)-10-methyl-9-phenylacridin-10-ium.
| Compound Name | 3,6-bis(3,3-difluoroazetidin-1-yl)-10-methyl-9-phenylacridin-10-ium |
|---|---|
| PubChem CID | 167484573 |
| Molecular Formula | C26H22F4N3+ |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3,6-bis(3,3-difluoroazetidin-1-yl)-10-methyl-9-phenylacridin-10-ium |
| SMILES | C[n+]1c2cc(N3CC(F)(F)C3)ccc2c(-c2ccccc2)c2ccc(N3CC(F)(F)C3)cc21 |
| InChI | InChI=1S/C26H22F4N3/c1-31-22-11-18(32-13-25(27,28)14-32)7-9-20(22)24(17-5-3-2-4-6-17)21-10-8-19(12-23(21)31)33-15-26(29,30)16-33/h2-12H,13-16H2,1H3/q+1 |
| InChIKey | GIVDVGHYLXPYLN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|