C15H23Cl — CID 138493357
1-chloro-4-(4-propylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 138493357) has the molecular formula C15H23Cl and a molecular weight of 238.80 g/mol. Its IUPAC name is 1-chloro-4-(4-propylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 1-chloro-4-(4-propylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 138493357 |
| Molecular Formula | C15H23Cl |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-chloro-4-(4-propylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C2=CC=C(Cl)CC2)CC1 |
| InChI | InChI=1S/C15H23Cl/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h8,10,12-13H,2-7,9,11H2,1H3 |
| InChIKey | ZNVYDOJDEJBLNO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |