C10H12F3N3O2 — CID 138494618
butyl N-[3-(trifluoromethyl)pyrazin-2-yl]carbamate (PubChem CID 138494618) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is butyl N-[3-(trifluoromethyl)pyrazin-2-yl]carbamate.
| Compound Name | butyl N-[3-(trifluoromethyl)pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 138494618 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | butyl N-[3-(trifluoromethyl)pyrazin-2-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nccnc1C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O2/c1-2-3-6-18-9(17)16-8-7(10(11,12)13)14-4-5-15-8/h4-5H,2-3,6H2,1H3,(H,15,16,17) |
| InChIKey | WKGFMULTHVGLRI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|