C12H13FN6O2 — CID 138495272
1-[(E)-(4-fluorophenyl)methylideneamino]-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea (PubChem CID 138495272) has the molecular formula C12H13FN6O2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-[(E)-(4-fluorophenyl)methylideneamino]-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea.
| Compound Name | 1-[(E)-(4-fluorophenyl)methylideneamino]-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea |
|---|---|
| PubChem CID | 138495272 |
| Molecular Formula | C12H13FN6O2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-[(E)-(4-fluorophenyl)methylideneamino]-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea |
| SMILES | CC1=NNC(=O)N(NC(=O)N/N=C/c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C12H13FN6O2/c1-8-7-19(12(21)17-15-8)18-11(20)16-14-6-9-2-4-10(13)5-3-9/h2-6H,7H2,1H3,(H,17,21)(H2,16,18,20)/b14-6+ |
| InChIKey | NTRLCKWULMIKTG-MKMNVTDBSA-N |
| XLogP | 0.77 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|