C23H38N4O2 — CID 138495616
(Z)-N-[2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-(3,4,5-trimethyl-3H-1,2,4-triazol-2-yl)pent-2-enamide (PubChem CID 138495616) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (Z)-N-[2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-(3,4,5-trimethyl-3H-1,2,4-triazol-2-yl)pent-2-enamide.
| Compound Name | (Z)-N-[2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-(3,4,5-trimethyl-3H-1,2,4-triazol-2-yl)pent-2-enamide |
|---|---|
| PubChem CID | 138495616 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (Z)-N-[2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-(3,4,5-trimethyl-3H-1,2,4-triazol-2-yl)pent-2-enamide |
| SMILES | C=C/C(C)=C/CC1OC(C)C(NC(=O)/C=C\C(C)N2N=C(C)N(C)C2C)CC1C |
| InChI | InChI=1S/C23H38N4O2/c1-9-15(2)10-12-22-16(3)14-21(18(5)29-22)24-23(28)13-11-17(4)27-20(7)26(8)19(6)25-27/h9-11,13,16-18,20-22H,1,12,14H2,2-8H3,(H,24,28)/b13-11-,15-10+ |
| InChIKey | OCMPRMDZTAENPC-TXYYUMDWSA-N |
| XLogP | 3.68 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|