C25H39NO4 — CID 134550377
(Z)-N-[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide (PubChem CID 134550377) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (Z)-N-[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 134550377 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (Z)-N-[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide |
| SMILES | CC(/C=C/C1CC2(CCO1)CO2)=C\CC1OC(C)C(NC(=O)/C=C\C(C)C)CC1C |
| InChI | InChI=1S/C25H39NO4/c1-17(2)6-11-24(27)26-22-14-19(4)23(30-20(22)5)10-8-18(3)7-9-21-15-25(16-29-25)12-13-28-21/h6-9,11,17,19-23H,10,12-16H2,1-5H3,(H,26,27)/b9-7+,11-6-,18-8+ |
| InChIKey | RTHYMOWIRXSTAG-RQTVVTFVSA-N |
| XLogP | 4.34 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|