C31H50N2O7 — CID 144618249
[(Z)-5-[[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate;N-methylbutanamide (PubChem CID 144618249) has the molecular formula C31H50N2O7 and a molecular weight of 562.75 g/mol. Its IUPAC name is [(Z)-5-[[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate;N-methylbutanamide.
| Compound Name | [(Z)-5-[[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate;N-methylbutanamide |
|---|---|
| PubChem CID | 144618249 |
| Molecular Formula | C31H50N2O7 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | [(Z)-5-[[6-[(2E,4E)-5-(1,6-dioxaspiro[2.5]octan-5-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate;N-methylbutanamide |
| SMILES | CC(=O)OC(C)/C=C\C(=O)NC1CC(C)C(C/C=C(C)/C=C/C2CC3(CCO2)CO3)OC1C.CCCC(=O)NC |
| InChI | InChI=1S/C26H39NO6.C5H11NO/c1-17(6-9-22-15-26(16-31-26)12-13-30-22)7-10-24-18(2)14-23(20(4)33-24)27-25(29)11-8-19(3)32-21(5)28;1-3-4-5(7)6-2/h6-9,11,18-20,22-24H,10,12-16H2,1-5H3,(H,27,29);3-4H2,1-2H3,(H,6,7)/b9-6+,11-8-,17-7+; |
| InChIKey | BASRRJXXLZAKAI-MAMZVODISA-N |
| XLogP | 4.17 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|