C24H39NO5 — CID 134550106
(Z)-4-hydroxy-N-[6-[(2E,4E)-5-(4-hydroxy-4-methyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide (PubChem CID 134550106) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is (Z)-4-hydroxy-N-[6-[(2E,4E)-5-(4-hydroxy-4-methyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide.
| Compound Name | (Z)-4-hydroxy-N-[6-[(2E,4E)-5-(4-hydroxy-4-methyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 134550106 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (Z)-4-hydroxy-N-[6-[(2E,4E)-5-(4-hydroxy-4-methyloxan-2-yl)-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
| SMILES | CC(/C=C/C1CC(C)(O)CCO1)=C\CC1OC(C)C(NC(=O)/C=C\C(C)O)CC1C |
| InChI | InChI=1S/C24H39NO5/c1-16(6-9-20-15-24(5,28)12-13-29-20)7-10-22-17(2)14-21(19(4)30-22)25-23(27)11-8-18(3)26/h6-9,11,17-22,26,28H,10,12-15H2,1-5H3,(H,25,27)/b9-6+,11-8-,16-7+ |
| InChIKey | DYIUPRGRJBQYPC-UOEMFJLTSA-N |
| XLogP | 3.04 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|