C25H43NO5 — CID 170047993
(Z)-4-hydroxy-N-[6-[(2E,4E)-8-(hydroxymethyl)-6-methoxy-3-methyldeca-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide (PubChem CID 170047993) has the molecular formula C25H43NO5 and a molecular weight of 437.62 g/mol. Its IUPAC name is (Z)-4-hydroxy-N-[6-[(2E,4E)-8-(hydroxymethyl)-6-methoxy-3-methyldeca-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide.
| Compound Name | (Z)-4-hydroxy-N-[6-[(2E,4E)-8-(hydroxymethyl)-6-methoxy-3-methyldeca-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 170047993 |
| Molecular Formula | C25H43NO5 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | (Z)-4-hydroxy-N-[6-[(2E,4E)-8-(hydroxymethyl)-6-methoxy-3-methyldeca-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
| SMILES | CCC(CO)CC(/C=C/C(C)=C/CC1OC(C)C(NC(=O)/C=C\C(C)O)CC1C)OC |
| InChI | InChI=1S/C25H43NO5/c1-7-21(16-27)15-22(30-6)11-8-17(2)9-12-24-18(3)14-23(20(5)31-24)26-25(29)13-10-19(4)28/h8-11,13,18-24,27-28H,7,12,14-16H2,1-6H3,(H,26,29)/b11-8+,13-10-,17-9+ |
| InChIKey | QXBSFVBFKYQULV-XQZPPZKHSA-N |
| XLogP | 3.54 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|