C18H30INO3 — CID 134982269
tert-butyl N-[(2R,3R,5S,6S)-6-[(2E,4Z)-5-iodo-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]carbamate (PubChem CID 134982269) has the molecular formula C18H30INO3 and a molecular weight of 435.35 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,5S,6S)-6-[(2E,4Z)-5-iodo-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,5S,6S)-6-[(2E,4Z)-5-iodo-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 134982269 |
| Molecular Formula | C18H30INO3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | tert-butyl N-[(2R,3R,5S,6S)-6-[(2E,4Z)-5-iodo-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]carbamate |
| SMILES | CC(/C=C\I)=C\C[C@@H]1O[C@H](C)[C@H](NC(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C18H30INO3/c1-12(9-10-19)7-8-16-13(2)11-15(14(3)22-16)20-17(21)23-18(4,5)6/h7,9-10,13-16H,8,11H2,1-6H3,(H,20,21)/b10-9-,12-7+/t13-,14+,15+,16-/m0/s1 |
| InChIKey | MHROAMXDJHIJSV-VPNXSODHSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|