C29H45NO6 — CID 160923147
methyl 2-[(5S,7R,8S)-7-[(1E,3E)-5-[(2S,3S,5R,6R)-3,6-dimethyl-5-[[(Z)-4-methylpent-2-enoyl]amino]oxan-2-yl]-3-methylpenta-1,3-dienyl]-8-hydroxy-6-oxaspiro[2.5]octan-5-yl]acetate (PubChem CID 160923147) has the molecular formula C29H45NO6 and a molecular weight of 503.68 g/mol. Its IUPAC name is methyl 2-[(5S,7R,8S)-7-[(1E,3E)-5-[(2S,3S,5R,6R)-3,6-dimethyl-5-[[(Z)-4-methylpent-2-enoyl]amino]oxan-2-yl]-3-methylpenta-1,3-dienyl]-8-hydroxy-6-oxaspiro[2.5]octan-5-yl]acetate.
| Compound Name | methyl 2-[(5S,7R,8S)-7-[(1E,3E)-5-[(2S,3S,5R,6R)-3,6-dimethyl-5-[[(Z)-4-methylpent-2-enoyl]amino]oxan-2-yl]-3-methylpenta-1,3-dienyl]-8-hydroxy-6-oxaspiro[2.5]octan-5-yl]acetate |
|---|---|
| PubChem CID | 160923147 |
| Molecular Formula | C29H45NO6 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | methyl 2-[(5S,7R,8S)-7-[(1E,3E)-5-[(2S,3S,5R,6R)-3,6-dimethyl-5-[[(Z)-4-methylpent-2-enoyl]amino]oxan-2-yl]-3-methylpenta-1,3-dienyl]-8-hydroxy-6-oxaspiro[2.5]octan-5-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC2(CC2)[C@H](O)[C@@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\C(C)C)C[C@@H]2C)O1 |
| InChI | InChI=1S/C29H45NO6/c1-18(2)7-12-26(31)30-23-15-20(4)24(35-21(23)5)10-8-19(3)9-11-25-28(33)29(13-14-29)17-22(36-25)16-27(32)34-6/h7-9,11-12,18,20-25,28,33H,10,13-17H2,1-6H3,(H,30,31)/b11-9+,12-7-,19-8+/t20-,21+,22+,23+,24-,25+,28+/m0/s1 |
| InChIKey | SSHGBEDBPRCYCD-SGCHKJRFSA-N |
| XLogP | 4.25 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|