C23H39NO2 — CID 144618423
(Z)-N-[6-[(2E,4E)-3,6-dimethylocta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide (PubChem CID 144618423) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (Z)-N-[6-[(2E,4E)-3,6-dimethylocta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[6-[(2E,4E)-3,6-dimethylocta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 144618423 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (Z)-N-[6-[(2E,4E)-3,6-dimethylocta-2,4-dienyl]-2,5-dimethyloxan-3-yl]-4-methylpent-2-enamide |
| SMILES | CCC(C)/C=C/C(C)=C/CC1OC(C)C(NC(=O)/C=C\C(C)C)CC1C |
| InChI | InChI=1S/C23H39NO2/c1-8-17(4)10-11-18(5)12-13-22-19(6)15-21(20(7)26-22)24-23(25)14-9-16(2)3/h9-12,14,16-17,19-22H,8,13,15H2,1-7H3,(H,24,25)/b11-10+,14-9-,18-12+ |
| InChIKey | IYPLLBMHZVSKTA-QMMPYLMYSA-N |
| XLogP | 5.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|