C26H41NO6 — CID 101135680
(Z,4S)-4-hydroxy-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(2R,3S,6S)-3-hydroxy-6-methoxy-6-methyl-4-methylideneoxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide (PubChem CID 101135680) has the molecular formula C26H41NO6 and a molecular weight of 463.62 g/mol. Its IUPAC name is (Z,4S)-4-hydroxy-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(2R,3S,6S)-3-hydroxy-6-methoxy-6-methyl-4-methylideneoxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide.
| Compound Name | (Z,4S)-4-hydroxy-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(2R,3S,6S)-3-hydroxy-6-methoxy-6-methyl-4-methylideneoxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
|---|---|
| PubChem CID | 101135680 |
| Molecular Formula | C26H41NO6 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | (Z,4S)-4-hydroxy-N-[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(2R,3S,6S)-3-hydroxy-6-methoxy-6-methyl-4-methylideneoxan-2-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]pent-2-enamide |
| SMILES | C=C1C[C@@](C)(OC)O[C@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)O)C[C@@H]2C)[C@H]1O |
| InChI | InChI=1S/C26H41NO6/c1-16(9-12-23-25(30)18(3)15-26(6,31-7)33-23)8-11-22-17(2)14-21(20(5)32-22)27-24(29)13-10-19(4)28/h8-10,12-13,17,19-23,25,28,30H,3,11,14-15H2,1-2,4-7H3,(H,27,29)/b12-9+,13-10-,16-8+/t17-,19-,20+,21+,22-,23+,25-,26-/m0/s1 |
| InChIKey | GTQSEBLPLBSHBN-RZARBWAHSA-N |
| XLogP | 3.18 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|