C11H11N5 — CID 138500278
4-(1-ethyltriazol-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 138500278) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-(1-ethyltriazol-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(1-ethyltriazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 138500278 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-(1-ethyltriazol-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCn1cc(-c2ccnc3[nH]ccc23)nn1 |
| InChI | InChI=1S/C11H11N5/c1-2-16-7-10(14-15-16)8-3-5-12-11-9(8)4-6-13-11/h3-7H,2H2,1H3,(H,12,13) |
| InChIKey | ZSZQVQMTHDDMRZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |