C23H21FN4O2 — CID 138502950
methyl 2-[1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate (PubChem CID 138502950) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is methyl 2-[1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate.
| Compound Name | methyl 2-[1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
|---|---|
| PubChem CID | 138502950 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl 2-[1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxylate |
| SMILES | COC(=O)c1cc2c3c(c1)nc(-c1cc4ccc(F)cc4n1CC1CC1)n3CCN2 |
| InChI | InChI=1S/C23H21FN4O2/c1-30-23(29)15-8-17-21-18(9-15)26-22(27(21)7-6-25-17)20-10-14-4-5-16(24)11-19(14)28(20)12-13-2-3-13/h4-5,8-11,13,25H,2-3,6-7,12H2,1H3 |
| InChIKey | WMVKZLRWPDNEEV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |