C18H22N4O2 — CID 138509132
2-[amino-(2-aminobenzoyl)amino]-N-[(2,4-dimethylphenyl)methyl]acetamide (PubChem CID 138509132) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[amino-(2-aminobenzoyl)amino]-N-[(2,4-dimethylphenyl)methyl]acetamide.
| Compound Name | 2-[amino-(2-aminobenzoyl)amino]-N-[(2,4-dimethylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 138509132 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[amino-(2-aminobenzoyl)amino]-N-[(2,4-dimethylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN(N)C(=O)c2ccccc2N)c(C)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-12-7-8-14(13(2)9-12)10-21-17(23)11-22(20)18(24)15-5-3-4-6-16(15)19/h3-9H,10-11,19-20H2,1-2H3,(H,21,23) |
| InChIKey | OZFRBLCVVIBMKM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|