C17H18Cl2N4O2 — CID 138509218
2-[amino-(2-amino-3,5-dichlorobenzoyl)amino]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 138509218) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 2-[amino-(2-amino-3,5-dichlorobenzoyl)amino]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[amino-(2-amino-3,5-dichlorobenzoyl)amino]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 138509218 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[amino-(2-amino-3,5-dichlorobenzoyl)amino]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN(N)C(=O)c2cc(Cl)cc(Cl)c2N)cc1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c1-10-2-4-11(5-3-10)8-22-15(24)9-23(21)17(25)13-6-12(18)7-14(19)16(13)20/h2-7H,8-9,20-21H2,1H3,(H,22,24) |
| InChIKey | TWVFWAFMOHUBAZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|