C28H35N3O7 — CID 138509346
(4S,4aS,5aS,12aR)-4-[ethyl(methyl)amino]-1,10,11,12a-tetrahydroxy-4a-methyl-8-(1-methylpyrrolidin-2-yl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 138509346) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-[ethyl(methyl)amino]-1,10,11,12a-tetrahydroxy-4a-methyl-8-(1-methylpyrrolidin-2-yl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-[ethyl(methyl)amino]-1,10,11,12a-tetrahydroxy-4a-methyl-8-(1-methylpyrrolidin-2-yl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 138509346 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-[ethyl(methyl)amino]-1,10,11,12a-tetrahydroxy-4a-methyl-8-(1-methylpyrrolidin-2-yl)-3,12-dioxo-4,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CCN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5C)cc4C[C@H]3C[C@@]12C |
| InChI | InChI=1S/C28H35N3O7/c1-5-30(3)23-22(34)20(26(29)37)25(36)28(38)24(35)19-15(12-27(23,28)2)10-14-9-13(16-7-6-8-31(16)4)11-17(32)18(14)21(19)33/h9,11,15-16,23,32-33,36,38H,5-8,10,12H2,1-4H3,(H2,29,37)/t15-,16?,23+,27-,28-/m0/s1 |
| InChIKey | FTDKICGAKLDWDD-RENCWYKKSA-N |
| XLogP | 1.51 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|