C26H33NO2 — CID 138510680
ethyl 4-(1-methyl-3-phenyl-2-azaspiro[4.6]undecan-2-yl)benzoate (PubChem CID 138510680) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is ethyl 4-(1-methyl-3-phenyl-2-azaspiro[4.6]undecan-2-yl)benzoate.
| Compound Name | ethyl 4-(1-methyl-3-phenyl-2-azaspiro[4.6]undecan-2-yl)benzoate |
|---|---|
| PubChem CID | 138510680 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethyl 4-(1-methyl-3-phenyl-2-azaspiro[4.6]undecan-2-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(c3ccccc3)CC3(CCCCCC3)C2C)cc1 |
| InChI | InChI=1S/C26H33NO2/c1-3-29-25(28)22-13-15-23(16-14-22)27-20(2)26(17-9-4-5-10-18-26)19-24(27)21-11-7-6-8-12-21/h6-8,11-16,20,24H,3-5,9-10,17-19H2,1-2H3 |
| InChIKey | WBRQHQQPGUKELJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |