C22H27N2O2+ — CID 6975879
ethyl 4-[(3R,8aS)-3-phenyl-1,3,4,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium-2-yl]benzoate (PubChem CID 6975879) has the molecular formula C22H27N2O2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is ethyl 4-[(3R,8aS)-3-phenyl-1,3,4,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium-2-yl]benzoate.
| Compound Name | ethyl 4-[(3R,8aS)-3-phenyl-1,3,4,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium-2-yl]benzoate |
|---|---|
| PubChem CID | 6975879 |
| Molecular Formula | C22H27N2O2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | ethyl 4-[(3R,8aS)-3-phenyl-1,3,4,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridin-4-ium-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C[C@@H]3CCCC[NH+]3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-26-22(25)18-11-13-19(14-12-18)24-16-20-10-6-7-15-23(20)21(24)17-8-4-3-5-9-17/h3-5,8-9,11-14,20-21H,2,6-7,10,15-16H2,1H3/p+1/t20-,21-/m0/s1 |
| InChIKey | IUKCBZVVAUOCOM-SFTDATJTSA-O |
| XLogP | 2.82 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |