C23H29O4P — CID 138511520
8-[2-(3,5-dimethoxyphenyl)phenyl]-7,7-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane (PubChem CID 138511520) has the molecular formula C23H29O4P and a molecular weight of 400.46 g/mol. Its IUPAC name is 8-[2-(3,5-dimethoxyphenyl)phenyl]-7,7-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane.
| Compound Name | 8-[2-(3,5-dimethoxyphenyl)phenyl]-7,7-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
|---|---|
| PubChem CID | 138511520 |
| Molecular Formula | C23H29O4P |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 8-[2-(3,5-dimethoxyphenyl)phenyl]-7,7-dimethyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
| SMILES | COc1cc(OC)cc(-c2ccccc2P2CCC3(CC2(C)C)OCCO3)c1 |
| InChI | InChI=1S/C23H29O4P/c1-22(2)16-23(26-10-11-27-23)9-12-28(22)21-8-6-5-7-20(21)17-13-18(24-3)15-19(14-17)25-4/h5-8,13-15H,9-12,16H2,1-4H3 |
| InChIKey | QDWBKTRWXZYZIO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|