C41H54O7P2 — CID 160517252
8-[2-(2,6-dimethoxyphenyl)phenyl]-7,7,9,9-tetramethyl-1,4-dioxa-8-phosphaspiro[4.5]decane;1,3,5,7-tetramethyl-8-phenyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane (PubChem CID 160517252) has the molecular formula C41H54O7P2 and a molecular weight of 720.82 g/mol. Its IUPAC name is 8-[2-(2,6-dimethoxyphenyl)phenyl]-7,7,9,9-tetramethyl-1,4-dioxa-8-phosphaspiro[4.5]decane;1,3,5,7-tetramethyl-8-phenyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane.
| Compound Name | 8-[2-(2,6-dimethoxyphenyl)phenyl]-7,7,9,9-tetramethyl-1,4-dioxa-8-phosphaspiro[4.5]decane;1,3,5,7-tetramethyl-8-phenyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 160517252 |
| Molecular Formula | C41H54O7P2 |
| Molecular Weight | 720.82 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 8-[2-(2,6-dimethoxyphenyl)phenyl]-7,7,9,9-tetramethyl-1,4-dioxa-8-phosphaspiro[4.5]decane;1,3,5,7-tetramethyl-8-phenyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)P3c1ccccc1)O2.COc1cccc(OC)c1-c1ccccc1P1C(C)(C)CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C25H33O4P.C16H21O3P/c1-23(2)16-25(28-14-15-29-25)17-24(3,4)30(23)21-13-8-7-10-18(21)22-19(26-5)11-9-12-20(22)27-6;1-13-10-15(3)19-14(2,17-13)11-16(4,18-13)20(15)12-8-6-5-7-9-12/h7-13H,14-17H2,1-6H3;5-9H,10-11H2,1-4H3 |
| InChIKey | QTUUSXMIFUCIJE-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.82 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|