C41H41O6P — CID 175872413
8-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-7,9-diphenyl-1,4-dioxa-8-phosphaspiro[4.5]decane (PubChem CID 175872413) has the molecular formula C41H41O6P and a molecular weight of 660.75 g/mol. Its IUPAC name is 8-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-7,9-diphenyl-1,4-dioxa-8-phosphaspiro[4.5]decane.
| Compound Name | 8-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-7,9-diphenyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
|---|---|
| PubChem CID | 175872413 |
| Molecular Formula | C41H41O6P |
| Molecular Weight | 660.75 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 8-[2,6-bis(2,6-dimethoxyphenyl)phenyl]-7,9-diphenyl-1,4-dioxa-8-phosphaspiro[4.5]decane |
| SMILES | COc1cccc(OC)c1-c1cccc(-c2c(OC)cccc2OC)c1P1C(c2ccccc2)CC2(CC1c1ccccc1)OCCO2 |
| InChI | InChI=1S/C41H41O6P/c1-42-32-20-12-21-33(43-2)38(32)30-18-11-19-31(39-34(44-3)22-13-23-35(39)45-4)40(30)48-36(28-14-7-5-8-15-28)26-41(46-24-25-47-41)27-37(48)29-16-9-6-10-17-29/h5-23,36-37H,24-27H2,1-4H3 |
| InChIKey | DNVMCSMNQVZXNI-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.75 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|