C13H18N2O4S — CID 138522085
1-[4-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]ethylsulfamic acid (PubChem CID 138522085) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[4-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]ethylsulfamic acid.
| Compound Name | 1-[4-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]ethylsulfamic acid |
|---|---|
| PubChem CID | 138522085 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[4-(2-methyl-5-oxopyrrolidin-1-yl)phenyl]ethylsulfamic acid |
| SMILES | CC(NS(=O)(=O)O)c1ccc(N2C(=O)CCC2C)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-9-3-8-13(16)15(9)12-6-4-11(5-7-12)10(2)14-20(17,18)19/h4-7,9-10,14H,3,8H2,1-2H3,(H,17,18,19) |
| InChIKey | LJJZIMLAJILGDY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|