C21H33N3O — CID 46986888
5-methyl-1-[4-[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]phenyl]pyrrolidin-2-one (PubChem CID 46986888) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is 5-methyl-1-[4-[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 5-methyl-1-[4-[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 46986888 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 5-methyl-1-[4-[4-[[(2R)-3-methylbutan-2-yl]amino]piperidin-1-yl]phenyl]pyrrolidin-2-one |
| SMILES | CC(C)[C@@H](C)NC1CCN(c2ccc(N3C(=O)CCC3C)cc2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-15(2)17(4)22-18-11-13-23(14-12-18)19-6-8-20(9-7-19)24-16(3)5-10-21(24)25/h6-9,15-18,22H,5,10-14H2,1-4H3/t16?,17-/m1/s1 |
| InChIKey | XLGRDSGJCNCQGY-ZYMOGRSISA-N |
| XLogP | 3.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|