C23H35N3O2 — CID 46988870
1-[4-[4-[(2,2-dimethyloxan-4-yl)amino]piperidin-1-yl]phenyl]-5-methylpyrrolidin-2-one (PubChem CID 46988870) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[4-[4-[(2,2-dimethyloxan-4-yl)amino]piperidin-1-yl]phenyl]-5-methylpyrrolidin-2-one.
| Compound Name | 1-[4-[4-[(2,2-dimethyloxan-4-yl)amino]piperidin-1-yl]phenyl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 46988870 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-[4-[4-[(2,2-dimethyloxan-4-yl)amino]piperidin-1-yl]phenyl]-5-methylpyrrolidin-2-one |
| SMILES | CC1CCC(=O)N1c1ccc(N2CCC(NC3CCOC(C)(C)C3)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-17-4-9-22(27)26(17)21-7-5-20(6-8-21)25-13-10-18(11-14-25)24-19-12-15-28-23(2,3)16-19/h5-8,17-19,24H,4,9-16H2,1-3H3 |
| InChIKey | QFRNGGSZICUDFZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|