About [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid
[bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid (PubChem CID 138522099) has the molecular formula C16H35OPS
and a molecular weight of 306.50 g/mol. Its IUPAC name is [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid.
Molecular Properties
| Compound Name | [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid |
| PubChem CID | 138522099 |
| Molecular Formula | C16H35OPS |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid |
| SMILES | CC(C)CCCCCS(CCCCCC(C)C)=PO |
| InChI | InChI=1S/C16H35OPS/c1-15(2)11-7-5-9-13-19(18-17)14-10-6-8-12-16(3)4/h15-17H,5-14H2,1-4H3 |
| InChIKey | KMXKHGNIFHZXHA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid?
The IUPAC name of [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid (CID 138522099) is [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid.
What is the SMILES notation for [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid?
The canonical SMILES for [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid is CC(C)CCCCCS(CCCCCC(C)C)=PO.
What is the InChIKey of [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid?
The InChIKey is KMXKHGNIFHZXHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35OPS/c1-15(2)11-7-5-9-13-19(18-17)14-10-6-8-12-16(3)4/h15-17H,5-14H2,1-4H3.
What are the key properties of [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid?
[bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid has a molecular weight of 306.50 g/mol, XLogP of 5.81, 12 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(6-methylheptyl)-λ4-sulfanylidene]phosphinous acid is sourced from PubChem (CID 138522099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).