About 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane
3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane (PubChem CID 138525344) has the molecular formula C15H28F2N2O2
and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane.
Molecular Properties
| Compound Name | 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane |
| PubChem CID | 138525344 |
| Molecular Formula | C15H28F2N2O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane |
| SMILES | CC(C)OC1CCN(C(C)(C)N2CCCOC2)CC1(F)F |
| InChI | InChI=1S/C15H28F2N2O2/c1-12(2)21-13-6-8-18(10-15(13,16)17)14(3,4)19-7-5-9-20-11-19/h12-13H,5-11H2,1-4H3 |
| InChIKey | OZTSZTXHIZOGNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane?
The IUPAC name of 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane (CID 138525344) is 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane.
What is the SMILES notation for 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane?
The canonical SMILES for 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane is CC(C)OC1CCN(C(C)(C)N2CCCOC2)CC1(F)F.
What is the InChIKey of 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane?
The InChIKey is OZTSZTXHIZOGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2N2O2/c1-12(2)21-13-6-8-18(10-15(13,16)17)14(3,4)19-7-5-9-20-11-19/h12-13H,5-11H2,1-4H3.
What are the key properties of 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane?
3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane has a molecular weight of 306.40 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,3-difluoro-4-propan-2-yloxypiperidin-1-yl)propan-2-yl]-1,3-oxazinane is sourced from PubChem (CID 138525344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).