C16H24F2N2O3 — CID 162573002
tert-butyl 4-(3-cyanopent-4-en-2-yloxy)-3,3-difluoropiperidine-1-carboxylate (PubChem CID 162573002) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl 4-(3-cyanopent-4-en-2-yloxy)-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-cyanopent-4-en-2-yloxy)-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162573002 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl 4-(3-cyanopent-4-en-2-yloxy)-3,3-difluoropiperidine-1-carboxylate |
| SMILES | C=CC(C#N)C(C)OC1CCN(C(=O)OC(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C16H24F2N2O3/c1-6-12(9-19)11(2)22-13-7-8-20(10-16(13,17)18)14(21)23-15(3,4)5/h6,11-13H,1,7-8,10H2,2-5H3 |
| InChIKey | TZDPKUZFDCFNNT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|