C28H54N4O5 — CID 138527060
(2S)-2-formamido-6-[[4-(3-formamido-3-methylbutoxy)-4-methylpentanoyl]amino]-N-(2,5,5-trimethylhexan-2-yl)hexanamide (PubChem CID 138527060) has the molecular formula C28H54N4O5 and a molecular weight of 526.76 g/mol. Its IUPAC name is (2S)-2-formamido-6-[[4-(3-formamido-3-methylbutoxy)-4-methylpentanoyl]amino]-N-(2,5,5-trimethylhexan-2-yl)hexanamide.
| Compound Name | (2S)-2-formamido-6-[[4-(3-formamido-3-methylbutoxy)-4-methylpentanoyl]amino]-N-(2,5,5-trimethylhexan-2-yl)hexanamide |
|---|---|
| PubChem CID | 138527060 |
| Molecular Formula | C28H54N4O5 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.41 |
| IUPAC Name | (2S)-2-formamido-6-[[4-(3-formamido-3-methylbutoxy)-4-methylpentanoyl]amino]-N-(2,5,5-trimethylhexan-2-yl)hexanamide |
| SMILES | CC(C)(C)CCC(C)(C)NC(=O)[C@H](CCCCNC(=O)CCC(C)(C)OCCC(C)(C)NC=O)NC=O |
| InChI | InChI=1S/C28H54N4O5/c1-25(2,3)15-16-27(6,7)32-24(36)22(30-20-33)12-10-11-18-29-23(35)13-14-28(8,9)37-19-17-26(4,5)31-21-34/h20-22H,10-19H2,1-9H3,(H,29,35)(H,30,33)(H,31,34)(H,32,36)/t22-/m0/s1 |
| InChIKey | HEMGOGPSEGDSRL-QFIPXVFZSA-N |
| XLogP | 3.60 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|