C23H33N3 — CID 138528375
(2E,3E)-2-ethylidene-4-[1-[[(3E,5E)-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-yl]amino]ethenyl]-5-(propylamino)hexa-3,5-dienenitrile (PubChem CID 138528375) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-[1-[[(3E,5E)-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-yl]amino]ethenyl]-5-(propylamino)hexa-3,5-dienenitrile.
| Compound Name | (2E,3E)-2-ethylidene-4-[1-[[(3E,5E)-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-yl]amino]ethenyl]-5-(propylamino)hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 138528375 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-[1-[[(3E,5E)-3-[(Z)-prop-1-enyl]hepta-3,5-dien-2-yl]amino]ethenyl]-5-(propylamino)hexa-3,5-dienenitrile |
| SMILES | C=C(NCCC)/C(=C\C(C#N)=C/C)C(=C)NC(C)C(/C=C\C)=C/C=C/C |
| InChI | InChI=1S/C23H33N3/c1-8-12-14-22(13-9-2)18(5)26-20(7)23(16-21(11-4)17-24)19(6)25-15-10-3/h8-9,11-14,16,18,25-26H,6-7,10,15H2,1-5H3/b12-8+,13-9-,21-11+,22-14+,23-16+ |
| InChIKey | TWJCQVSAZFABNZ-AWXPVZNNSA-N |
| XLogP | 5.47 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|