C25H26N4S — CID 1385334
1-[4-(9H-fluoren-9-yl)piperazin-1-yl]-3-(4-methylphenyl)thiourea (PubChem CID 1385334) has the molecular formula C25H26N4S and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[4-(9H-fluoren-9-yl)piperazin-1-yl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[4-(9H-fluoren-9-yl)piperazin-1-yl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 1385334 |
| Molecular Formula | C25H26N4S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[4-(9H-fluoren-9-yl)piperazin-1-yl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NN2CCN(C3c4ccccc4-c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C25H26N4S/c1-18-10-12-19(13-11-18)26-25(30)27-29-16-14-28(15-17-29)24-22-8-4-2-6-20(22)21-7-3-5-9-23(21)24/h2-13,24H,14-17H2,1H3,(H2,26,27,30) |
| InChIKey | XMOKZRPDLXBTHS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|