C11H13F3N4O2S — CID 138538170
ethyl 2-methylsulfanyl-4-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]pyrimidine-5-carboxylate (PubChem CID 138538170) has the molecular formula C11H13F3N4O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 138538170 |
| Molecular Formula | C11H13F3N4O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-[(2E)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1N/N=C(\C)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O2S/c1-4-20-9(19)7-5-15-10(21-3)16-8(7)18-17-6(2)11(12,13)14/h5H,4H2,1-3H3,(H,15,16,18)/b17-6+ |
| InChIKey | RTJUQPGZEJSERH-UBKPWBPPSA-N |
| XLogP | 2.73 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|