C24H26N2O4 — CID 138544887
phenylmethoxycarbonylamino 4,4-dimethyl-2-quinolin-6-ylpentanoate (PubChem CID 138544887) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is phenylmethoxycarbonylamino 4,4-dimethyl-2-quinolin-6-ylpentanoate.
| Compound Name | phenylmethoxycarbonylamino 4,4-dimethyl-2-quinolin-6-ylpentanoate |
|---|---|
| PubChem CID | 138544887 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | phenylmethoxycarbonylamino 4,4-dimethyl-2-quinolin-6-ylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)ONC(=O)OCc1ccccc1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C24H26N2O4/c1-24(2,3)15-20(18-11-12-21-19(14-18)10-7-13-25-21)22(27)30-26-23(28)29-16-17-8-5-4-6-9-17/h4-14,20H,15-16H2,1-3H3,(H,26,28) |
| InChIKey | LAJWHOVOBQHCFB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|