C23H26N2O4 — CID 155061664
benzyl 4-[2-hydroxy-3-(quinolin-6-ylamino)propoxy]butanoate (PubChem CID 155061664) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 4-[2-hydroxy-3-(quinolin-6-ylamino)propoxy]butanoate.
| Compound Name | benzyl 4-[2-hydroxy-3-(quinolin-6-ylamino)propoxy]butanoate |
|---|---|
| PubChem CID | 155061664 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 4-[2-hydroxy-3-(quinolin-6-ylamino)propoxy]butanoate |
| SMILES | O=C(CCCOCC(O)CNc1ccc2ncccc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C23H26N2O4/c26-21(15-25-20-10-11-22-19(14-20)8-4-12-24-22)17-28-13-5-9-23(27)29-16-18-6-2-1-3-7-18/h1-4,6-8,10-12,14,21,25-26H,5,9,13,15-17H2 |
| InChIKey | GKLXXUYKZZBLKI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|